C15H16ClN5O — CID 141438173
1-(azetidin-1-yl)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-en-1-one (PubChem CID 141438173) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-(azetidin-1-yl)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141438173 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(azetidin-1-yl)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-en-1-one |
| SMILES | Cc1nnn(Cc2cc(Cl)ccc2C=CC(=O)N2CCC2)n1 |
| InChI | InChI=1S/C15H16ClN5O/c1-11-17-19-21(18-11)10-13-9-14(16)5-3-12(13)4-6-15(22)20-7-2-8-20/h3-6,9H,2,7-8,10H2,1H3 |
| InChIKey | ZPHHEJJHOVSHRC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|