C18H19ClF3N5O — CID 162662887
(E)-1-(4-chloropiperidin-1-yl)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 162662887) has the molecular formula C18H19ClF3N5O and a molecular weight of 413.83 g/mol. Its IUPAC name is (E)-1-(4-chloropiperidin-1-yl)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-chloropiperidin-1-yl)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162662887 |
| Molecular Formula | C18H19ClF3N5O |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (E)-1-(4-chloropiperidin-1-yl)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | Cc1nnn(Cc2cc(C(F)(F)F)ccc2/C=C/C(=O)N2CCC(Cl)CC2)n1 |
| InChI | InChI=1S/C18H19ClF3N5O/c1-12-23-25-27(24-12)11-14-10-15(18(20,21)22)4-2-13(14)3-5-17(28)26-8-6-16(19)7-9-26/h2-5,10,16H,6-9,11H2,1H3/b5-3+ |
| InChIKey | LPIHDDUMXQSQSN-HWKANZROSA-N |
| XLogP | 3.29 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|