C19H21ClN8O — CID 90645936
(E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(triazol-2-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 90645936) has the molecular formula C19H21ClN8O and a molecular weight of 412.89 g/mol. Its IUPAC name is (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(triazol-2-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(triazol-2-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90645936 |
| Molecular Formula | C19H21ClN8O |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(triazol-2-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nnn(Cc2cc(Cl)ccc2/C=C/C(=O)N2CCC(n3nccn3)CC2)n1 |
| InChI | InChI=1S/C19H21ClN8O/c1-14-23-25-27(24-14)13-16-12-17(20)4-2-15(16)3-5-19(29)26-10-6-18(7-11-26)28-21-8-9-22-28/h2-5,8-9,12,18H,6-7,10-11,13H2,1H3/b5-3+ |
| InChIKey | JHBRIHHCFHSJKC-HWKANZROSA-N |
| XLogP | 2.15 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|