C23H22ClFN6O2 — CID 162664598
(E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorobenzoyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 162664598) has the molecular formula C23H22ClFN6O2 and a molecular weight of 468.92 g/mol. Its IUPAC name is (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorobenzoyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorobenzoyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162664598 |
| Molecular Formula | C23H22ClFN6O2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (E)-3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorobenzoyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nnn(Cc2cc(Cl)ccc2/C=C/C(=O)N2CCN(C(=O)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C23H22ClFN6O2/c1-16-26-28-31(27-16)15-19-14-20(24)6-2-17(19)5-9-22(32)29-10-12-30(13-11-29)23(33)18-3-7-21(25)8-4-18/h2-9,14H,10-13,15H2,1H3/b9-5+ |
| InChIKey | AVBFNSZQGFIAMU-WEVVVXLNSA-N |
| XLogP | 2.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|