C23H23ClFN5O — CID 123608927
3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorophenyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 123608927) has the molecular formula C23H23ClFN5O and a molecular weight of 439.92 g/mol. Its IUPAC name is 3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorophenyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorophenyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123608927 |
| Molecular Formula | C23H23ClFN5O |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-[4-chloro-2-[(5-methyltetrazol-2-yl)methyl]phenyl]-1-[4-(4-fluorophenyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nnn(Cc2cc(Cl)ccc2C=CC(=O)N2CCC(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C23H23ClFN5O/c1-16-26-28-30(27-16)15-20-14-21(24)6-2-18(20)5-9-23(31)29-12-10-19(11-13-29)17-3-7-22(25)8-4-17/h2-9,14,19H,10-13,15H2,1H3 |
| InChIKey | RRFJXXBNOWFKOF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|