C26H33F3N8O — CID 144775309
(E)-1-[4-(2-cyclobutylimino-3-methyliminobutyl)piperazin-1-yl]-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 144775309) has the molecular formula C26H33F3N8O and a molecular weight of 530.60 g/mol. Its IUPAC name is (E)-1-[4-(2-cyclobutylimino-3-methyliminobutyl)piperazin-1-yl]-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-cyclobutylimino-3-methyliminobutyl)piperazin-1-yl]-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144775309 |
| Molecular Formula | C26H33F3N8O |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (E)-1-[4-(2-cyclobutylimino-3-methyliminobutyl)piperazin-1-yl]-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | C/N=C(C)/C(CN1CCN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2Cn2nnc(C)n2)CC1)=N\C1CCC1 |
| InChI | InChI=1S/C26H33F3N8O/c1-18(30-3)24(31-23-5-4-6-23)17-35-11-13-36(14-12-35)25(38)10-8-20-7-9-22(26(27,28)29)15-21(20)16-37-33-19(2)32-34-37/h7-10,15,23H,4-6,11-14,16-17H2,1-3H3/b10-8+,30-18+,31-24- |
| InChIKey | FBSJGNYDNWOHBL-XHAPBABPSA-N |
| XLogP | 3.29 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|