C26H25F4N7O4S — CID 172635980
4-[(3aR,6aR)-2-[(E)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-fluorobenzenesulfonamide (PubChem CID 172635980) has the molecular formula C26H25F4N7O4S and a molecular weight of 607.59 g/mol. Its IUPAC name is 4-[(3aR,6aR)-2-[(E)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(3aR,6aR)-2-[(E)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 172635980 |
| Molecular Formula | C26H25F4N7O4S |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 4-[(3aR,6aR)-2-[(E)-3-[2-[(5-methyltetrazol-2-yl)methyl]-4-(trifluoromethyl)phenyl]prop-2-enoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-fluorobenzenesulfonamide |
| SMILES | Cc1nnn(Cc2cc(C(F)(F)F)ccc2/C=C/C(=O)N2C[C@@H]3CN(C(=O)c4ccc(S(N)(=O)=O)cc4F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C26H25F4N7O4S/c1-15-32-34-37(33-15)14-17-8-20(26(28,29)30)4-2-16(17)3-7-24(38)35-10-18-12-36(13-19(18)11-35)25(39)22-6-5-21(9-23(22)27)42(31,40)41/h2-9,18-19H,10-14H2,1H3,(H2,31,40,41)/b7-3+/t18-,19-/m1/s1 |
| InChIKey | VROGQIVBHYOIKB-FAHYLIOHSA-N |
| XLogP | 2.08 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|