C11H10Cl3N3O — CID 94943704
[5-methyl-1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanol (PubChem CID 94943704) has the molecular formula C11H10Cl3N3O and a molecular weight of 306.58 g/mol. Its IUPAC name is [5-methyl-1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanol.
| Compound Name | [5-methyl-1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 94943704 |
| Molecular Formula | C11H10Cl3N3O |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | [5-methyl-1-[(2,3,6-trichlorophenyl)methyl]triazol-4-yl]methanol |
| SMILES | Cc1c(CO)nnn1Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl3N3O/c1-6-10(5-18)15-16-17(6)4-7-8(12)2-3-9(13)11(7)14/h2-3,18H,4-5H2,1H3 |
| InChIKey | XFYZJYQSXIZMNC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|