C12H9Cl3N4 — CID 94943705
5-ethyl-1-[(2,3,6-trichlorophenyl)methyl]triazole-4-carbonitrile (PubChem CID 94943705) has the molecular formula C12H9Cl3N4 and a molecular weight of 315.59 g/mol. Its IUPAC name is 5-ethyl-1-[(2,3,6-trichlorophenyl)methyl]triazole-4-carbonitrile.
| Compound Name | 5-ethyl-1-[(2,3,6-trichlorophenyl)methyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 94943705 |
| Molecular Formula | C12H9Cl3N4 |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 5-ethyl-1-[(2,3,6-trichlorophenyl)methyl]triazole-4-carbonitrile |
| SMILES | CCc1c(C#N)nnn1Cc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H9Cl3N4/c1-2-11-10(5-16)17-18-19(11)6-7-8(13)3-4-9(14)12(7)15/h3-4H,2,6H2,1H3 |
| InChIKey | AMHLFTYDQGPRTE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|