About [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol
[1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol (PubChem CID 82205346) has the molecular formula C13H15Cl2N3O
and a molecular weight of 300.19 g/mol. Its IUPAC name is [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol |
| PubChem CID | 82205346 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol |
| SMILES | CCCCn1nnc(CO)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O/c1-2-3-6-18-13(12(8-19)16-17-18)9-4-5-10(14)11(15)7-9/h4-5,7,19H,2-3,6,8H2,1H3 |
| InChIKey | WIXJGBWNUGCSMR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The IUPAC name of [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol (CID 82205346) is [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol.
What is the SMILES notation for [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The canonical SMILES for [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol is CCCCn1nnc(CO)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol?
The InChIKey is WIXJGBWNUGCSMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3O/c1-2-3-6-18-13(12(8-19)16-17-18)9-4-5-10(14)11(15)7-9/h4-5,7,19H,2-3,6,8H2,1H3.
What are the key properties of [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol?
[1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol has a molecular weight of 300.19 g/mol, XLogP of 3.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-butyl-5-(3,4-dichlorophenyl)triazol-4-yl]methanol is sourced from PubChem (CID 82205346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).