C18H27N3O — CID 82208060
[5-(3,4-dimethylphenyl)-1-heptyltriazol-4-yl]methanol (PubChem CID 82208060) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is [5-(3,4-dimethylphenyl)-1-heptyltriazol-4-yl]methanol.
| Compound Name | [5-(3,4-dimethylphenyl)-1-heptyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82208060 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | [5-(3,4-dimethylphenyl)-1-heptyltriazol-4-yl]methanol |
| SMILES | CCCCCCCn1nnc(CO)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H27N3O/c1-4-5-6-7-8-11-21-18(17(13-22)19-20-21)16-10-9-14(2)15(3)12-16/h9-10,12,22H,4-8,11,13H2,1-3H3 |
| InChIKey | VIZFLQDMEWBGSP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|