C13H13Cl2N3O2 — CID 94943927
1-butyl-5-(3,4-dichlorophenyl)triazole-4-carboxylic acid (PubChem CID 94943927) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 1-butyl-5-(3,4-dichlorophenyl)triazole-4-carboxylic acid.
| Compound Name | 1-butyl-5-(3,4-dichlorophenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94943927 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-butyl-5-(3,4-dichlorophenyl)triazole-4-carboxylic acid |
| SMILES | CCCCn1nnc(C(=O)O)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-2-3-6-18-12(11(13(19)20)16-17-18)8-4-5-9(14)10(15)7-8/h4-5,7H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | USIRVNWOFZCFGQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |