C11H13N3O3 — CID 82202111
1-butyl-5-(furan-2-yl)triazole-4-carboxylic acid (PubChem CID 82202111) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1-butyl-5-(furan-2-yl)triazole-4-carboxylic acid.
| Compound Name | 1-butyl-5-(furan-2-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202111 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-butyl-5-(furan-2-yl)triazole-4-carboxylic acid |
| SMILES | CCCCn1nnc(C(=O)O)c1-c1ccco1 |
| InChI | InChI=1S/C11H13N3O3/c1-2-3-6-14-10(8-5-4-7-17-8)9(11(15)16)12-13-14/h4-5,7H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | OVEUDXXAZANRGV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |