C10H10N4O4 — CID 82211199
5-(furan-2-yl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 82211199) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-(furan-2-yl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(furan-2-yl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82211199 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 5-(furan-2-yl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CNC(=O)Cn1nnc(C(=O)O)c1-c1ccco1 |
| InChI | InChI=1S/C10H10N4O4/c1-11-7(15)5-14-9(6-3-2-4-18-6)8(10(16)17)12-13-14/h2-4H,5H2,1H3,(H,11,15)(H,16,17) |
| InChIKey | DRIDJZCHICPQIK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |