C15H15N5O3 — CID 94946232
5-(1H-indol-3-ylmethyl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 94946232) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 5-(1H-indol-3-ylmethyl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(1H-indol-3-ylmethyl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94946232 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-(1H-indol-3-ylmethyl)-1-[2-(methylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CNC(=O)Cn1nnc(C(=O)O)c1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H15N5O3/c1-16-13(21)8-20-12(14(15(22)23)18-19-20)6-9-7-17-11-5-3-2-4-10(9)11/h2-5,7,17H,6,8H2,1H3,(H,16,21)(H,22,23) |
| InChIKey | JONDMFQHAOEXSA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |