C14H16N4O4 — CID 82202406
1-[2-(benzylamino)-2-oxoethyl]-5-(methoxymethyl)triazole-4-carboxylic acid (PubChem CID 82202406) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[2-(benzylamino)-2-oxoethyl]-5-(methoxymethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(benzylamino)-2-oxoethyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202406 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[2-(benzylamino)-2-oxoethyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
| SMILES | COCc1c(C(=O)O)nnn1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H16N4O4/c1-22-9-11-13(14(20)21)16-17-18(11)8-12(19)15-7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,15,19)(H,20,21) |
| InChIKey | PAXCZZHONLZCAP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |