C12H11N3O5 — CID 56766399
1-(carboxymethyl)-5-(phenoxymethyl)triazole-4-carboxylic acid (PubChem CID 56766399) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 1-(carboxymethyl)-5-(phenoxymethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(carboxymethyl)-5-(phenoxymethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56766399 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(carboxymethyl)-5-(phenoxymethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)Cn1nnc(C(=O)O)c1COc1ccccc1 |
| InChI | InChI=1S/C12H11N3O5/c16-10(17)6-15-9(11(12(18)19)13-14-15)7-20-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,16,17)(H,18,19) |
| InChIKey | MVOPZHZXDUJKPQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |