C9H13N3O4 — CID 82202252
1-(carboxymethyl)-5-(2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 82202252) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 1-(carboxymethyl)-5-(2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 1-(carboxymethyl)-5-(2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202252 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-(carboxymethyl)-5-(2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)nnn1CC(=O)O |
| InChI | InChI=1S/C9H13N3O4/c1-5(2)3-6-8(9(15)16)10-11-12(6)4-7(13)14/h5H,3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | PMLBOTJFCVJNCD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |