C13H22N4O3 — CID 82202249
5-(2-methylpropyl)-1-[2-(2-methylpropylamino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 82202249) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1-[2-(2-methylpropylamino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-methylpropyl)-1-[2-(2-methylpropylamino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202249 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 5-(2-methylpropyl)-1-[2-(2-methylpropylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | CC(C)CNC(=O)Cn1nnc(C(=O)O)c1CC(C)C |
| InChI | InChI=1S/C13H22N4O3/c1-8(2)5-10-12(13(19)20)15-16-17(10)7-11(18)14-6-9(3)4/h8-9H,5-7H2,1-4H3,(H,14,18)(H,19,20) |
| InChIKey | SPRGSAQIENWLPR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |