C15H26N4O3 — CID 94942316
1-[2-(dipropylamino)-2-oxoethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 94942316) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[2-(dipropylamino)-2-oxoethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(dipropylamino)-2-oxoethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94942316 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-[2-(dipropylamino)-2-oxoethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CCCN(CCC)C(=O)Cn1nnc(C(=O)O)c1CC(C)C |
| InChI | InChI=1S/C15H26N4O3/c1-5-7-18(8-6-2)13(20)10-19-12(9-11(3)4)14(15(21)22)16-17-19/h11H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | DYJQAZFTFGCIEV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |