C13H19N5O2 — CID 102645533
1-[2-(1-methylimidazol-2-yl)ethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 102645533) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)ethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)ethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645533 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)ethyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)nnn1CCc1nccn1C |
| InChI | InChI=1S/C13H19N5O2/c1-9(2)8-10-12(13(19)20)15-16-18(10)6-4-11-14-5-7-17(11)3/h5,7,9H,4,6,8H2,1-3H3,(H,19,20) |
| InChIKey | CDPFKJOAVITKDO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |