C10H14N6O2 — CID 103118866
5-(2-aminoethyl)-1-[(1-methylimidazol-2-yl)methyl]triazole-4-carboxylic acid (PubChem CID 103118866) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-[(1-methylimidazol-2-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethyl)-1-[(1-methylimidazol-2-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103118866 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 5-(2-aminoethyl)-1-[(1-methylimidazol-2-yl)methyl]triazole-4-carboxylic acid |
| SMILES | Cn1ccnc1Cn1nnc(C(=O)O)c1CCN |
| InChI | InChI=1S/C10H14N6O2/c1-15-5-4-12-8(15)6-16-7(2-3-11)9(10(17)18)13-14-16/h4-5H,2-3,6,11H2,1H3,(H,17,18) |
| InChIKey | DOUZCQSMSAFGHD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |