C13H14N4O2 — CID 123737077
3-[4-methyl-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 123737077) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-[4-methyl-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-methyl-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123737077 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-[4-methyl-2-[(5-methyltetrazol-2-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(C=CC(=O)O)c(Cn2nnc(C)n2)c1 |
| InChI | InChI=1S/C13H14N4O2/c1-9-3-4-11(5-6-13(18)19)12(7-9)8-17-15-10(2)14-16-17/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | LPQITHDLFIVJJG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|