C16H19Cl3N4O2S — CID 142105853
[2,6-dichloro-3-(2-chloro-6-oxocyclohexene-1-carbonyl)phenyl]methyl (1E)-N-aminomethanimidothioate;methylhydrazine (PubChem CID 142105853) has the molecular formula C16H19Cl3N4O2S and a molecular weight of 437.78 g/mol. Its IUPAC name is [2,6-dichloro-3-(2-chloro-6-oxocyclohexene-1-carbonyl)phenyl]methyl (1E)-N-aminomethanimidothioate;methylhydrazine.
| Compound Name | [2,6-dichloro-3-(2-chloro-6-oxocyclohexene-1-carbonyl)phenyl]methyl (1E)-N-aminomethanimidothioate;methylhydrazine |
|---|---|
| PubChem CID | 142105853 |
| Molecular Formula | C16H19Cl3N4O2S |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | [2,6-dichloro-3-(2-chloro-6-oxocyclohexene-1-carbonyl)phenyl]methyl (1E)-N-aminomethanimidothioate;methylhydrazine |
| SMILES | CNN.N/N=C/SCc1c(Cl)ccc(C(=O)C2=C(Cl)CCCC2=O)c1Cl |
| InChI | InChI=1S/C15H13Cl3N2O2S.CH6N2/c16-10-5-4-8(14(18)9(10)6-23-7-20-19)15(22)13-11(17)2-1-3-12(13)21;1-3-2/h4-5,7H,1-3,6,19H2;3H,2H2,1H3/b20-7+; |
| InChIKey | WFGUHZYXPNYCCP-YYJLQXKGSA-N |
| XLogP | 3.64 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|