C9H10F2O3 — CID 130495259
2-(2,2-difluoropropanoyl)cyclohexane-1,3-dione (PubChem CID 130495259) has the molecular formula C9H10F2O3 and a molecular weight of 204.17 g/mol. Its IUPAC name is 2-(2,2-difluoropropanoyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2,2-difluoropropanoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 130495259 |
| Molecular Formula | C9H10F2O3 |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(2,2-difluoropropanoyl)cyclohexane-1,3-dione |
| SMILES | CC(F)(F)C(=O)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C9H10F2O3/c1-9(10,11)8(14)7-5(12)3-2-4-6(7)13/h7H,2-4H2,1H3 |
| InChIKey | JTNUGBDYQPJNJM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|