C9H13F2NO2 — CID 131072178
2,2-difluoro-N-(4-oxocyclohexyl)propanamide (PubChem CID 131072178) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is 2,2-difluoro-N-(4-oxocyclohexyl)propanamide.
| Compound Name | 2,2-difluoro-N-(4-oxocyclohexyl)propanamide |
|---|---|
| PubChem CID | 131072178 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2,2-difluoro-N-(4-oxocyclohexyl)propanamide |
| SMILES | CC(F)(F)C(=O)NC1CCC(=O)CC1 |
| InChI | InChI=1S/C9H13F2NO2/c1-9(10,11)8(14)12-6-2-4-7(13)5-3-6/h6H,2-5H2,1H3,(H,12,14) |
| InChIKey | MPANQNDOWSKVBT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |