C10H19FN2O — CID 126982038
N-(4-aminocyclohexyl)-2-fluoro-2-methylpropanamide (PubChem CID 126982038) has the molecular formula C10H19FN2O and a molecular weight of 202.27 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-fluoro-2-methylpropanamide.
| Compound Name | N-(4-aminocyclohexyl)-2-fluoro-2-methylpropanamide |
|---|---|
| PubChem CID | 126982038 |
| Molecular Formula | C10H19FN2O |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-fluoro-2-methylpropanamide |
| SMILES | CC(C)(F)C(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C10H19FN2O/c1-10(2,11)9(14)13-8-5-3-7(12)4-6-8/h7-8H,3-6,12H2,1-2H3,(H,13,14) |
| InChIKey | FIEVPBNGEQCPGD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |