C12H23ClN2O2 — CID 166227849
N-(4-aminocyclohexyl)-3,3-dimethyl-2-oxobutanamide;hydrochloride (PubChem CID 166227849) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,3-dimethyl-2-oxobutanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3,3-dimethyl-2-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 166227849 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,3-dimethyl-2-oxobutanamide;hydrochloride |
| SMILES | CC(C)(C)C(=O)C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-12(2,3)10(15)11(16)14-9-6-4-8(13)5-7-9;/h8-9H,4-7,13H2,1-3H3,(H,14,16);1H |
| InChIKey | DCOWRFJHQXIMMF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|