C10H18FNO2 — CID 130165281
2-fluoro-N-(4-hydroxycyclohexyl)-2-methylpropanamide (PubChem CID 130165281) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-fluoro-N-(4-hydroxycyclohexyl)-2-methylpropanamide.
| Compound Name | 2-fluoro-N-(4-hydroxycyclohexyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 130165281 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-fluoro-N-(4-hydroxycyclohexyl)-2-methylpropanamide |
| SMILES | CC(C)(F)C(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C10H18FNO2/c1-10(2,11)9(14)12-7-3-5-8(13)6-4-7/h7-8,13H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | WBIGDMKYWVUWIA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |