C16H19NO3 — CID 106765776
1-(4-methylpentoxy)isoquinoline-4-carboxylic acid (PubChem CID 106765776) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-(4-methylpentoxy)isoquinoline-4-carboxylic acid.
| Compound Name | 1-(4-methylpentoxy)isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106765776 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(4-methylpentoxy)isoquinoline-4-carboxylic acid |
| SMILES | CC(C)CCCOc1ncc(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C16H19NO3/c1-11(2)6-5-9-20-15-13-8-4-3-7-12(13)14(10-17-15)16(18)19/h3-4,7-8,10-11H,5-6,9H2,1-2H3,(H,18,19) |
| InChIKey | WGYKDPSDNREJOL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|