C11H8F10NO3S+ — CID 175528766
1,1,2,2,3,3,4,6,6,6-decafluorohexyl pyridin-1-ium-1-sulfonate (PubChem CID 175528766) has the molecular formula C11H8F10NO3S+ and a molecular weight of 424.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,6,6,6-decafluorohexyl pyridin-1-ium-1-sulfonate.
| Compound Name | 1,1,2,2,3,3,4,6,6,6-decafluorohexyl pyridin-1-ium-1-sulfonate |
|---|---|
| PubChem CID | 175528766 |
| Molecular Formula | C11H8F10NO3S+ |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 1,1,2,2,3,3,4,6,6,6-decafluorohexyl pyridin-1-ium-1-sulfonate |
| SMILES | O=S(=O)(OC(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F)[n+]1ccccc1 |
| InChI | InChI=1S/C11H8F10NO3S/c12-7(6-8(13,14)15)9(16,17)10(18,19)11(20,21)25-26(23,24)22-4-2-1-3-5-22/h1-5,7H,6H2/q+1 |
| InChIKey | YDGGGPOJPXGUKT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|