C11H13F12OSi — CID 170562709
CID 170562709 (PubChem CID 170562709) has the molecular formula C11H13F12OSi and a molecular weight of 417.29 g/mol.
| Compound Name | CID 170562709 |
|---|---|
| PubChem CID | 170562709 |
| Molecular Formula | C11H13F12OSi |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | — |
| SMILES | CCC[Si](OC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C11H13F12OSi/c1-3-4-25(24-2)11(22,23)10(20,21)9(18,19)8(16,17)6(12)5-7(13,14)15/h6H,3-5H2,1-2H3 |
| InChIKey | CSPSILKWJMGLBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|