C18H20F20O3Si — CID 175026560
1,1,1,3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-icosafluoropentadecan-2-yl(trimethoxy)silane (PubChem CID 175026560) has the molecular formula C18H20F20O3Si and a molecular weight of 692.40 g/mol. Its IUPAC name is 1,1,1,3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-icosafluoropentadecan-2-yl(trimethoxy)silane.
| Compound Name | 1,1,1,3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-icosafluoropentadecan-2-yl(trimethoxy)silane |
|---|---|
| PubChem CID | 175026560 |
| Molecular Formula | C18H20F20O3Si |
| Molecular Weight | 692.40 g/mol |
| Exact Mass | 692.09 |
| IUPAC Name | 1,1,1,3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-icosafluoropentadecan-2-yl(trimethoxy)silane |
| SMILES | CO[Si](OC)(OC)C(C(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F20O3Si/c1-39-42(40-2,41-3)13(17(34,35)36)12(27)16(32,33)18(37,38)15(30,31)11(26)9(24)7(22)5(20)4(19)6(21)8(23)10(25)14(28)29/h4-14H,1-3H3 |
| InChIKey | ZPKFIFPXAXYOGB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.40 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|