C15H17F17OSi — CID 175447972
3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-heptadecafluoropentadecan-2-yloxysilane (PubChem CID 175447972) has the molecular formula C15H17F17OSi and a molecular weight of 564.35 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-heptadecafluoropentadecan-2-yloxysilane.
| Compound Name | 3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-heptadecafluoropentadecan-2-yloxysilane |
|---|---|
| PubChem CID | 175447972 |
| Molecular Formula | C15H17F17OSi |
| Molecular Weight | 564.35 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 3,4,4,5,5,6,6,7,8,9,10,11,12,13,14,15,15-heptadecafluoropentadecan-2-yloxysilane |
| SMILES | CC(O[SiH3])C(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C15H17F17OSi/c1-2(33-34)10(23)13(27,28)15(31,32)14(29,30)11(24)8(21)6(19)4(17)3(16)5(18)7(20)9(22)12(25)26/h2-12H,1,34H3 |
| InChIKey | XLCWVKDJSUKHJG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|