C8H8F10O — CID 174239213
1,2,2,3,3,4,5,6,7,7-decafluoro-1-methoxyheptane (PubChem CID 174239213) has the molecular formula C8H8F10O and a molecular weight of 310.13 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,6,7,7-decafluoro-1-methoxyheptane.
| Compound Name | 1,2,2,3,3,4,5,6,7,7-decafluoro-1-methoxyheptane |
|---|---|
| PubChem CID | 174239213 |
| Molecular Formula | C8H8F10O |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1,2,2,3,3,4,5,6,7,7-decafluoro-1-methoxyheptane |
| SMILES | COC(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C8H8F10O/c1-19-6(14)8(17,18)7(15,16)4(11)2(9)3(10)5(12)13/h2-6H,1H3 |
| InChIKey | DCHKEVVLYRDERH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|