C15H9F17O4 — CID 88686333
2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-3-methylidenebutanedioic acid (PubChem CID 88686333) has the molecular formula C15H9F17O4 and a molecular weight of 576.20 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-3-methylidenebutanedioic acid.
| Compound Name | 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 88686333 |
| Molecular Formula | C15H9F17O4 |
| Molecular Weight | 576.20 g/mol |
| Exact Mass | 576.02 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,9,10,10-heptadecafluorodecyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(C(=O)O)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C15H9F17O4/c1-2(8(33)34)3(9(35)36)5(17)10(21,22)12(25,26)14(29,30)15(31,32)13(27,28)11(23,24)6(18)4(16)7(19)20/h3-7H,1H2,(H,33,34)(H,35,36) |
| InChIKey | NYAHRHGUKHZCOJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.20 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|