C9H9F7O4 — CID 175532754
2-(1,2,3,4,5,6,6-heptafluorohexyl)propanedioic acid (PubChem CID 175532754) has the molecular formula C9H9F7O4 and a molecular weight of 314.15 g/mol. Its IUPAC name is 2-(1,2,3,4,5,6,6-heptafluorohexyl)propanedioic acid.
| Compound Name | 2-(1,2,3,4,5,6,6-heptafluorohexyl)propanedioic acid |
|---|---|
| PubChem CID | 175532754 |
| Molecular Formula | C9H9F7O4 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-(1,2,3,4,5,6,6-heptafluorohexyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C9H9F7O4/c10-2(1(8(17)18)9(19)20)3(11)4(12)5(13)6(14)7(15)16/h1-7H,(H,17,18)(H,19,20) |
| InChIKey | BXPCLQFVJCKGAY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|