C6H9FO7 — CID 91022433
(2R,3S,4R,5R)-3-fluoro-2,4,5-trihydroxyhexanedioic acid (PubChem CID 91022433) has the molecular formula C6H9FO7 and a molecular weight of 212.13 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-fluoro-2,4,5-trihydroxyhexanedioic acid.
| Compound Name | (2R,3S,4R,5R)-3-fluoro-2,4,5-trihydroxyhexanedioic acid |
|---|---|
| PubChem CID | 91022433 |
| Molecular Formula | C6H9FO7 |
| Molecular Weight | 212.13 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (2R,3S,4R,5R)-3-fluoro-2,4,5-trihydroxyhexanedioic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](F)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C6H9FO7/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,8-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| InChIKey | DZZXHSOFNSCDIO-LLEIAEIESA-N |
| XLogP | -2.42 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.13 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |