C18H18F18O2 — CID 163324532
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,18-octadecafluorooctadecanoic acid (PubChem CID 163324532) has the molecular formula C18H18F18O2 and a molecular weight of 608.30 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,18-octadecafluorooctadecanoic acid.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,18-octadecafluorooctadecanoic acid |
|---|---|
| PubChem CID | 163324532 |
| Molecular Formula | C18H18F18O2 |
| Molecular Weight | 608.30 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,18-octadecafluorooctadecanoic acid |
| SMILES | O=C(O)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C18H18F18O2/c19-1(3(21)5(23)7(25)9(27)11(29)13(31)15(33)17(35)36)2(20)4(22)6(24)8(26)10(28)12(30)14(32)16(34)18(37)38/h1-17H,(H,37,38) |
| InChIKey | DQQWYFPUSZOIPI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.30 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |