C11H13F13Si — CID 87918105
trimethyl(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane (PubChem CID 87918105) has the molecular formula C11H13F13Si and a molecular weight of 420.29 g/mol. Its IUPAC name is trimethyl(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane.
| Compound Name | trimethyl(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 87918105 |
| Molecular Formula | C11H13F13Si |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | trimethyl(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](C)(C)C |
| InChI | InChI=1S/C11H13F13Si/c1-5(12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)25(2,3)4/h5H,1-4H3 |
| InChIKey | GUMOQIYASQZZIM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|