C14H16Cl9F13Si4 — CID 87967611
tris(2-trichlorosilylethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane (PubChem CID 87967611) has the molecular formula C14H16Cl9F13Si4 and a molecular weight of 862.68 g/mol. Its IUPAC name is tris(2-trichlorosilylethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane.
| Compound Name | tris(2-trichlorosilylethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 87967611 |
| Molecular Formula | C14H16Cl9F13Si4 |
| Molecular Weight | 862.68 g/mol |
| Exact Mass | 857.73 |
| IUPAC Name | tris(2-trichlorosilylethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)silane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](CC[Si](Cl)(Cl)Cl)(CC[Si](Cl)(Cl)Cl)CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C14H16Cl9F13Si4/c1-8(24)9(25,26)10(27,28)11(29,30)12(31,32)13(33,34)14(35,36)37(2-5-38(15,16)17,3-6-39(18,19)20)4-7-40(21,22)23/h8H,2-7H2,1H3 |
| InChIKey | HUROJOXYJJHZEE-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.68 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|