nonan-3-ol;2,2,2-trifluoroacetic acid

C11H21F3O3 — CID 175151448

IUPACnonan-3-ol;2,2,2-trifluoroacetic acid
SMILESCCCCCCC(O)CC.O=C(O)C(F)(F)F
InChIInChI=1S/C9H20O.C2HF3O2/c1-3-5-6-7-8-9(10)4-2;3-2(4,5)1(6)7/h9-10H,3-8H2,1-2H3;(H,6,7)
InChIKeyZNSIMMNJVIJHQO-UHFFFAOYSA-N
MW258.28 g/mol
LogP3.36
Rot. Bonds6

About nonan-3-ol;2,2,2-trifluoroacetic acid

nonan-3-ol;2,2,2-trifluoroacetic acid (PubChem CID 175151448) has the molecular formula C11H21F3O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is nonan-3-ol;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namenonan-3-ol;2,2,2-trifluoroacetic acid
PubChem CID175151448
Molecular FormulaC11H21F3O3
Molecular Weight258.28 g/mol
Exact Mass258.14
IUPAC Namenonan-3-ol;2,2,2-trifluoroacetic acid
SMILESCCCCCCC(O)CC.O=C(O)C(F)(F)F
InChIInChI=1S/C9H20O.C2HF3O2/c1-3-5-6-7-8-9(10)4-2;3-2(4,5)1(6)7/h9-10H,3-8H2,1-2H3;(H,6,7)
InChIKeyZNSIMMNJVIJHQO-UHFFFAOYSA-N
XLogP3.36
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 53.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze nonan-3-ol;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of nonan-3-ol;2,2,2-trifluoroacetic acid?
The IUPAC name of nonan-3-ol;2,2,2-trifluoroacetic acid (CID 175151448) is nonan-3-ol;2,2,2-trifluoroacetic acid.
What is the SMILES notation for nonan-3-ol;2,2,2-trifluoroacetic acid?
The canonical SMILES for nonan-3-ol;2,2,2-trifluoroacetic acid is CCCCCCC(O)CC.O=C(O)C(F)(F)F.
What is the InChIKey of nonan-3-ol;2,2,2-trifluoroacetic acid?
The InChIKey is ZNSIMMNJVIJHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O.C2HF3O2/c1-3-5-6-7-8-9(10)4-2;3-2(4,5)1(6)7/h9-10H,3-8H2,1-2H3;(H,6,7).
What are the key properties of nonan-3-ol;2,2,2-trifluoroacetic acid?
nonan-3-ol;2,2,2-trifluoroacetic acid has a molecular weight of 258.28 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-ol;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175151448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).