C11H21F3O3 — CID 175151448
nonan-3-ol;2,2,2-trifluoroacetic acid (PubChem CID 175151448) has the molecular formula C11H21F3O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is nonan-3-ol;2,2,2-trifluoroacetic acid.
| Compound Name | nonan-3-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175151448 |
| Molecular Formula | C11H21F3O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | nonan-3-ol;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCC(O)CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H20O.C2HF3O2/c1-3-5-6-7-8-9(10)4-2;3-2(4,5)1(6)7/h9-10H,3-8H2,1-2H3;(H,6,7) |
| InChIKey | ZNSIMMNJVIJHQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|