C9H7Cl2F13Si — CID 173413078
dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctyl)silane (PubChem CID 173413078) has the molecular formula C9H7Cl2F13Si and a molecular weight of 461.12 g/mol. Its IUPAC name is dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctyl)silane.
| Compound Name | dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctyl)silane |
|---|---|
| PubChem CID | 173413078 |
| Molecular Formula | C9H7Cl2F13Si |
| Molecular Weight | 461.12 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | dichloro-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-methyloctyl)silane |
| SMILES | CC(C[SiH](Cl)Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F13Si/c1-3(2-25(10)11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h3,25H,2H2,1H3 |
| InChIKey | DAEJJXJZVWTDCK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.12 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|