C8H6F13NaO3S — CID 174850316
sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-2-sulfonic acid (PubChem CID 174850316) has the molecular formula C8H6F13NaO3S and a molecular weight of 452.16 g/mol. Its IUPAC name is sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-2-sulfonic acid.
| Compound Name | sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-2-sulfonic acid |
|---|---|
| PubChem CID | 174850316 |
| Molecular Formula | C8H6F13NaO3S |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-2-sulfonic acid |
| SMILES | CC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C8H5F13O3S.Na.H/c1-2(25(22,23)24)3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h2H,1H3,(H,22,23,24);;/q;+1;-1 |
| InChIKey | HBNRDEXOTHDZCA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|