C6HBrF12O3S — CID 175485071
1-bromo-1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexane-1-sulfonic acid (PubChem CID 175485071) has the molecular formula C6HBrF12O3S and a molecular weight of 461.02 g/mol. Its IUPAC name is 1-bromo-1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexane-1-sulfonic acid.
| Compound Name | 1-bromo-1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 175485071 |
| Molecular Formula | C6HBrF12O3S |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 459.86 |
| IUPAC Name | 1-bromo-1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HBrF12O3S/c7-5(16,23(20,21)22)3(12,13)1(8,9)2(10,11)4(14,15)6(17,18)19/h(H,20,21,22) |
| InChIKey | AXTFASCPEAOBCJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|