C12H27N — CID 138642965
(2R,7S)-5,5,7-trimethylnonan-2-amine (PubChem CID 138642965) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is (2R,7S)-5,5,7-trimethylnonan-2-amine.
| Compound Name | (2R,7S)-5,5,7-trimethylnonan-2-amine |
|---|---|
| PubChem CID | 138642965 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (2R,7S)-5,5,7-trimethylnonan-2-amine |
| SMILES | CC[C@H](C)CC(C)(C)CC[C@@H](C)N |
| InChI | InChI=1S/C12H27N/c1-6-10(2)9-12(4,5)8-7-11(3)13/h10-11H,6-9,13H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | UICFNRXIMVAIKT-WDEREUQCSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |