C16H39N — CID 144514577
ethane;5,5,7,7-tetramethyloctan-2-amine (PubChem CID 144514577) has the molecular formula C16H39N and a molecular weight of 245.49 g/mol. Its IUPAC name is ethane;5,5,7,7-tetramethyloctan-2-amine.
| Compound Name | ethane;5,5,7,7-tetramethyloctan-2-amine |
|---|---|
| PubChem CID | 144514577 |
| Molecular Formula | C16H39N |
| Molecular Weight | 245.49 g/mol |
| Exact Mass | 245.31 |
| IUPAC Name | ethane;5,5,7,7-tetramethyloctan-2-amine |
| SMILES | CC.CC.CC(N)CCC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H27N.2C2H6/c1-10(13)7-8-12(5,6)9-11(2,3)4;2*1-2/h10H,7-9,13H2,1-6H3;2*1-2H3 |
| InChIKey | HETIICWNZNSCMY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |