C15H14F16I2 — CID 89419170
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,10-diiodo-12-methyltetradecane (PubChem CID 89419170) has the molecular formula C15H14F16I2 and a molecular weight of 752.05 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,10-diiodo-12-methyltetradecane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,10-diiodo-12-methyltetradecane |
|---|---|
| PubChem CID | 89419170 |
| Molecular Formula | C15H14F16I2 |
| Molecular Weight | 752.05 g/mol |
| Exact Mass | 751.89 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,10-diiodo-12-methyltetradecane |
| SMILES | CCC(C)CC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C15H14F16I2/c1-3-6(2)4-7(32)5-8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)33/h6-7H,3-5H2,1-2H3 |
| InChIKey | BLMJKNOEPGEEBW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.05 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|