C16H26F9ISi — CID 175836380
(4,4,5,5,6,6,7,7,7-nonafluoro-2-iodoheptyl)-tri(propan-2-yl)silane (PubChem CID 175836380) has the molecular formula C16H26F9ISi and a molecular weight of 544.36 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,7-nonafluoro-2-iodoheptyl)-tri(propan-2-yl)silane.
| Compound Name | (4,4,5,5,6,6,7,7,7-nonafluoro-2-iodoheptyl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 175836380 |
| Molecular Formula | C16H26F9ISi |
| Molecular Weight | 544.36 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | (4,4,5,5,6,6,7,7,7-nonafluoro-2-iodoheptyl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](CC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H26F9ISi/c1-9(2)27(10(3)4,11(5)6)8-12(26)7-13(17,18)14(19,20)15(21,22)16(23,24)25/h9-12H,7-8H2,1-6H3 |
| InChIKey | WRODXCDFBPCFTC-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.36 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|