C8H20ClN — CID 171379469
N,2-diethylbutan-1-amine;hydrochloride (PubChem CID 171379469) has the molecular formula C8H20ClN and a molecular weight of 165.71 g/mol. Its IUPAC name is N,2-diethylbutan-1-amine;hydrochloride.
| Compound Name | N,2-diethylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171379469 |
| Molecular Formula | C8H20ClN |
| Molecular Weight | 165.71 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N,2-diethylbutan-1-amine;hydrochloride |
| SMILES | CCNCC(CC)CC.Cl |
| InChI | InChI=1S/C8H19N.ClH/c1-4-8(5-2)7-9-6-3;/h8-9H,4-7H2,1-3H3;1H |
| InChIKey | WNQZZQZOVROZEE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |